C22H26ClNO — CID 158787869
(2R)-N-(4-chlorophenyl)-2-[4-(4-methylphenyl)cyclohexyl]propanamide (PubChem CID 158787869) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[4-(4-methylphenyl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[4-(4-methylphenyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 158787869 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[4-(4-methylphenyl)cyclohexyl]propanamide |
| SMILES | Cc1ccc(C2CCC([C@@H](C)C(=O)Nc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClNO/c1-15-3-5-18(6-4-15)19-9-7-17(8-10-19)16(2)22(25)24-21-13-11-20(23)12-14-21/h3-6,11-14,16-17,19H,7-10H2,1-2H3,(H,24,25)/t16-,17?,19?/m1/s1 |
| InChIKey | IRXIHXZUNZXRKW-LRYGQEGESA-N |
| XLogP | 6.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |