C22H24N2O — CID 121325031
(2R)-N-(4-cyanophenyl)-2-(4-phenylcyclohexyl)propanamide (PubChem CID 121325031) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (2R)-N-(4-cyanophenyl)-2-(4-phenylcyclohexyl)propanamide.
| Compound Name | (2R)-N-(4-cyanophenyl)-2-(4-phenylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 121325031 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (2R)-N-(4-cyanophenyl)-2-(4-phenylcyclohexyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(C#N)cc1)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N2O/c1-16(22(25)24-21-13-7-17(15-23)8-14-21)18-9-11-20(12-10-18)19-5-3-2-4-6-19/h2-8,13-14,16,18,20H,9-12H2,1H3,(H,24,25)/t16-,18?,20?/m1/s1 |
| InChIKey | LRZZYVRRXOODFO-PPDQVPDSSA-N |
| XLogP | 5.11 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |