C22H26N3O+ — CID 2654178
(2S)-2-(4-benzylpiperidin-1-ium-1-yl)-N-(4-cyanophenyl)propanamide (PubChem CID 2654178) has the molecular formula C22H26N3O+ and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S)-2-(4-benzylpiperidin-1-ium-1-yl)-N-(4-cyanophenyl)propanamide.
| Compound Name | (2S)-2-(4-benzylpiperidin-1-ium-1-yl)-N-(4-cyanophenyl)propanamide |
|---|---|
| PubChem CID | 2654178 |
| Molecular Formula | C22H26N3O+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (2S)-2-(4-benzylpiperidin-1-ium-1-yl)-N-(4-cyanophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(C#N)cc1)[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O/c1-17(22(26)24-21-9-7-20(16-23)8-10-21)25-13-11-19(12-14-25)15-18-5-3-2-4-6-18/h2-10,17,19H,11-15H2,1H3,(H,24,26)/p+1/t17-/m0/s1 |
| InChIKey | LJUWAZDWTBRSIZ-KRWDZBQOSA-O |
| XLogP | 2.42 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |