C25H24N4O — CID 109161603
6-(4-benzylpiperidin-1-yl)-N-(4-cyanophenyl)pyridine-3-carboxamide (PubChem CID 109161603) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-(4-cyanophenyl)pyridine-3-carboxamide.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-(4-cyanophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161603 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-(4-cyanophenyl)pyridine-3-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc(N3CCC(Cc4ccccc4)CC3)nc2)cc1 |
| InChI | InChI=1S/C25H24N4O/c26-17-21-6-9-23(10-7-21)28-25(30)22-8-11-24(27-18-22)29-14-12-20(13-15-29)16-19-4-2-1-3-5-19/h1-11,18,20H,12-16H2,(H,28,30) |
| InChIKey | UXKGWNQESLKDOU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |