C23H25N3OS — CID 1448003
6-(4-benzylpiperidin-1-yl)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 1448003) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1448003 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccc(N2CCC(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C23H25N3OS/c27-23(25-17-21-7-4-14-28-21)20-8-9-22(24-16-20)26-12-10-19(11-13-26)15-18-5-2-1-3-6-18/h1-9,14,16,19H,10-13,15,17H2,(H,25,27) |
| InChIKey | JJAHZPCODPHDBX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |