C27H28N4OS — CID 42878260
4-(4-benzylpiperidin-1-yl)-N-(2-thiophen-2-ylethyl)phthalazine-1-carboxamide (PubChem CID 42878260) has the molecular formula C27H28N4OS and a molecular weight of 456.62 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)-N-(2-thiophen-2-ylethyl)phthalazine-1-carboxamide.
| Compound Name | 4-(4-benzylpiperidin-1-yl)-N-(2-thiophen-2-ylethyl)phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42878260 |
| Molecular Formula | C27H28N4OS |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)-N-(2-thiophen-2-ylethyl)phthalazine-1-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1nnc(N2CCC(Cc3ccccc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C27H28N4OS/c32-27(28-15-12-22-9-6-18-33-22)25-23-10-4-5-11-24(23)26(30-29-25)31-16-13-21(14-17-31)19-20-7-2-1-3-8-20/h1-11,18,21H,12-17,19H2,(H,28,32) |
| InChIKey | HJOMXTZKUGUYBI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |