C27H27N5O — CID 42690736
4-(4-benzylpiperidin-1-yl)-N-(pyridin-3-ylmethyl)phthalazine-1-carboxamide (PubChem CID 42690736) has the molecular formula C27H27N5O and a molecular weight of 437.55 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)-N-(pyridin-3-ylmethyl)phthalazine-1-carboxamide.
| Compound Name | 4-(4-benzylpiperidin-1-yl)-N-(pyridin-3-ylmethyl)phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690736 |
| Molecular Formula | C27H27N5O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)-N-(pyridin-3-ylmethyl)phthalazine-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1nnc(N2CCC(Cc3ccccc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C27H27N5O/c33-27(29-19-22-9-6-14-28-18-22)25-23-10-4-5-11-24(23)26(31-30-25)32-15-12-21(13-16-32)17-20-7-2-1-3-8-20/h1-11,14,18,21H,12-13,15-17,19H2,(H,29,33) |
| InChIKey | AGQWCMFEHUACAV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |