C26H24ClN5O — CID 42690841
N-benzyl-4-[4-(2-chlorophenyl)piperazin-1-yl]phthalazine-1-carboxamide (PubChem CID 42690841) has the molecular formula C26H24ClN5O and a molecular weight of 457.97 g/mol. Its IUPAC name is N-benzyl-4-[4-(2-chlorophenyl)piperazin-1-yl]phthalazine-1-carboxamide.
| Compound Name | N-benzyl-4-[4-(2-chlorophenyl)piperazin-1-yl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690841 |
| Molecular Formula | C26H24ClN5O |
| Molecular Weight | 457.97 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-benzyl-4-[4-(2-chlorophenyl)piperazin-1-yl]phthalazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1nnc(N2CCN(c3ccccc3Cl)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H24ClN5O/c27-22-12-6-7-13-23(22)31-14-16-32(17-15-31)25-21-11-5-4-10-20(21)24(29-30-25)26(33)28-18-19-8-2-1-3-9-19/h1-13H,14-18H2,(H,28,33) |
| InChIKey | ROVYLONNAPEXGY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.97 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |