C24H26ClN5O2 — CID 42690864
4-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)phthalazine-1-carboxamide (PubChem CID 42690864) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)phthalazine-1-carboxamide.
| Compound Name | 4-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690864 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)phthalazine-1-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1nnc(N2CCN(c3ccccc3Cl)CC2)c2ccccc12 |
| InChI | InChI=1S/C24H26ClN5O2/c25-20-9-3-4-10-21(20)29-11-13-30(14-12-29)23-19-8-2-1-7-18(19)22(27-28-23)24(31)26-16-17-6-5-15-32-17/h1-4,7-10,17H,5-6,11-16H2,(H,26,31) |
| InChIKey | RHDYGONJDMVRFU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |