C17H26Cl3N3O2 — CID 119827710
1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(oxolan-2-ylmethylamino)ethanone;dihydrochloride (PubChem CID 119827710) has the molecular formula C17H26Cl3N3O2 and a molecular weight of 410.77 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(oxolan-2-ylmethylamino)ethanone;dihydrochloride.
| Compound Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(oxolan-2-ylmethylamino)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119827710 |
| Molecular Formula | C17H26Cl3N3O2 |
| Molecular Weight | 410.77 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-2-(oxolan-2-ylmethylamino)ethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CNCC1CCCO1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O2.2ClH/c18-15-5-1-2-6-16(15)20-7-9-21(10-8-20)17(22)13-19-12-14-4-3-11-23-14;;/h1-2,5-6,14,19H,3-4,7-13H2;2*1H |
| InChIKey | GWULOLNMSDKSIQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |