C17H23ClN2O3 — CID 124695340
1-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-2-[[(2S)-oxolan-2-yl]methylamino]ethanone (PubChem CID 124695340) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is 1-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-2-[[(2S)-oxolan-2-yl]methylamino]ethanone.
| Compound Name | 1-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-2-[[(2S)-oxolan-2-yl]methylamino]ethanone |
|---|---|
| PubChem CID | 124695340 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]-2-[[(2S)-oxolan-2-yl]methylamino]ethanone |
| SMILES | O=C(CNC[C@@H]1CCCO1)N1CCO[C@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c18-15-6-2-1-5-14(15)16-12-20(7-9-23-16)17(21)11-19-10-13-4-3-8-22-13/h1-2,5-6,13,16,19H,3-4,7-12H2/t13-,16-/m0/s1 |
| InChIKey | VPMAEXYLQBXAFI-BBRMVZONSA-N |
| XLogP | 2.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |