C16H21ClN2O3 — CID 95326549
(2S)-2-(2-chlorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]morpholine-4-carboxamide (PubChem CID 95326549) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]morpholine-4-carboxamide.
| Compound Name | (2S)-2-(2-chlorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 95326549 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-N-[[(2S)-oxolan-2-yl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)N1CCO[C@@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H21ClN2O3/c17-14-6-2-1-5-13(14)15-11-19(7-9-22-15)16(20)18-10-12-4-3-8-21-12/h1-2,5-6,12,15H,3-4,7-11H2,(H,18,20)/t12-,15+/m0/s1 |
| InChIKey | QXBXGKIZMYBAEK-SWLSCSKDSA-N |
| XLogP | 2.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |