C16H21ClN2O2 — CID 119318503
[2-(2-chlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone (PubChem CID 119318503) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is [2-(2-chlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone.
| Compound Name | [2-(2-chlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 119318503 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [2-(2-chlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone |
| SMILES | O=C(C1CCCNC1)N1CCOC(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H21ClN2O2/c17-14-6-2-1-5-13(14)15-11-19(8-9-21-15)16(20)12-4-3-7-18-10-12/h1-2,5-6,12,15,18H,3-4,7-11H2 |
| InChIKey | FTZNURIUMSAIIL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |