C16H20Cl2N2O2 — CID 119315643
[2-(3,4-dichlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone (PubChem CID 119315643) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone.
| Compound Name | [2-(3,4-dichlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 119315643 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [2-(3,4-dichlorophenyl)morpholin-4-yl]-piperidin-3-ylmethanone |
| SMILES | O=C(C1CCCNC1)N1CCOC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c17-13-4-3-11(8-14(13)18)15-10-20(6-7-22-15)16(21)12-2-1-5-19-9-12/h3-4,8,12,15,19H,1-2,5-7,9-10H2 |
| InChIKey | QWILKMYVYYIEFQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |