C15H19Cl2FN2O3 — CID 119769231
[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-morpholin-2-ylmethanone;hydrochloride (PubChem CID 119769231) has the molecular formula C15H19Cl2FN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is [2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-morpholin-2-ylmethanone;hydrochloride.
| Compound Name | [2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-morpholin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119769231 |
| Molecular Formula | C15H19Cl2FN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-morpholin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CNCCO1)N1CCOC(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H18ClFN2O3.ClH/c16-11-7-10(1-2-12(11)17)14-9-19(4-6-22-14)15(20)13-8-18-3-5-21-13;/h1-2,7,13-14,18H,3-6,8-9H2;1H |
| InChIKey | JTQNUTQUCQOMBC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |