C15H14ClFN4O2 — CID 119110800
(3-aminopyrazin-2-yl)-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]methanone (PubChem CID 119110800) has the molecular formula C15H14ClFN4O2 and a molecular weight of 336.75 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 119110800 |
| Molecular Formula | C15H14ClFN4O2 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]methanone |
| SMILES | Nc1nccnc1C(=O)N1CCOC(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H14ClFN4O2/c16-10-7-9(1-2-11(10)17)12-8-21(5-6-23-12)15(22)13-14(18)20-4-3-19-13/h1-4,7,12H,5-6,8H2,(H2,18,20) |
| InChIKey | CUECSVQHKBCARP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |