C15H15FN4O2 — CID 38374250
(3-aminopyrazin-2-yl)-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]methanone (PubChem CID 38374250) has the molecular formula C15H15FN4O2 and a molecular weight of 302.31 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 38374250 |
| Molecular Formula | C15H15FN4O2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]methanone |
| SMILES | Nc1nccnc1C(=O)N1CCO[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H15FN4O2/c16-11-3-1-10(2-4-11)12-9-20(7-8-22-12)15(21)13-14(17)19-6-5-18-13/h1-6,12H,7-9H2,(H2,17,19)/t12-/m1/s1 |
| InChIKey | RWZRNBAIVRXPFC-GFCCVEGCSA-N |
| XLogP | 1.41 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |