C20H19FN4O2 — CID 56864270
(3-amino-4-phenyl-1H-pyrazol-5-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone (PubChem CID 56864270) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is (3-amino-4-phenyl-1H-pyrazol-5-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone.
| Compound Name | (3-amino-4-phenyl-1H-pyrazol-5-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 56864270 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3-amino-4-phenyl-1H-pyrazol-5-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone |
| SMILES | Nc1n[nH]c(C(=O)N2CCOC(c3ccc(F)cc3)C2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H19FN4O2/c21-15-8-6-13(7-9-15)16-12-25(10-11-27-16)20(26)18-17(19(22)24-23-18)14-4-2-1-3-5-14/h1-9,16H,10-12H2,(H3,22,23,24) |
| InChIKey | WNPVGPSBAMECKC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |