C18H23ClFNO3 — CID 119042146
1-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone (PubChem CID 119042146) has the molecular formula C18H23ClFNO3 and a molecular weight of 355.84 g/mol. Its IUPAC name is 1-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone.
| Compound Name | 1-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone |
|---|---|
| PubChem CID | 119042146 |
| Molecular Formula | C18H23ClFNO3 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[2-(3-chloro-4-fluorophenyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone |
| SMILES | O=C(CC1(O)CCCCC1)N1CCOC(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H23ClFNO3/c19-14-10-13(4-5-15(14)20)16-12-21(8-9-24-16)17(22)11-18(23)6-2-1-3-7-18/h4-5,10,16,23H,1-3,6-9,11-12H2 |
| InChIKey | NUUYUFVTFIKDJD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |