C17H25N3O3 — CID 124943141
1-[(2S)-2-(6-amino-2-pyridinyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone (PubChem CID 124943141) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-[(2S)-2-(6-amino-2-pyridinyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone.
| Compound Name | 1-[(2S)-2-(6-amino-2-pyridinyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone |
|---|---|
| PubChem CID | 124943141 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[(2S)-2-(6-amino-2-pyridinyl)morpholin-4-yl]-2-(1-hydroxycyclohexyl)ethanone |
| SMILES | Nc1cccc([C@@H]2CN(C(=O)CC3(O)CCCCC3)CCO2)n1 |
| InChI | InChI=1S/C17H25N3O3/c18-15-6-4-5-13(19-15)14-12-20(9-10-23-14)16(21)11-17(22)7-2-1-3-8-17/h4-6,14,22H,1-3,7-12H2,(H2,18,19)/t14-/m0/s1 |
| InChIKey | BAMLXUDWQZXNOX-AWEZNQCLSA-N |
| XLogP | 1.65 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |