C17H22ClNO3 — CID 111430703
1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(1-hydroxycyclopentyl)ethanone (PubChem CID 111430703) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(1-hydroxycyclopentyl)ethanone.
| Compound Name | 1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(1-hydroxycyclopentyl)ethanone |
|---|---|
| PubChem CID | 111430703 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[2-(4-chlorophenyl)morpholin-4-yl]-2-(1-hydroxycyclopentyl)ethanone |
| SMILES | O=C(CC1(O)CCCC1)N1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H22ClNO3/c18-14-5-3-13(4-6-14)15-12-19(9-10-22-15)16(20)11-17(21)7-1-2-8-17/h3-6,15,21H,1-2,7-12H2 |
| InChIKey | LYMPBVKTFXQUOX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |