C14H16ClNO3 — CID 60951251
1-[2-(4-chlorophenyl)morpholin-4-yl]butane-1,3-dione (PubChem CID 60951251) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)morpholin-4-yl]butane-1,3-dione.
| Compound Name | 1-[2-(4-chlorophenyl)morpholin-4-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 60951251 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)morpholin-4-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H16ClNO3/c1-10(17)8-14(18)16-6-7-19-13(9-16)11-2-4-12(15)5-3-11/h2-5,13H,6-9H2,1H3 |
| InChIKey | VQIIBBYBLVOJPH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|