C16H23ClN2O2 — CID 82849703
5-amino-1-[2-(4-chlorophenyl)morpholin-4-yl]hexan-1-one (PubChem CID 82849703) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 5-amino-1-[2-(4-chlorophenyl)morpholin-4-yl]hexan-1-one.
| Compound Name | 5-amino-1-[2-(4-chlorophenyl)morpholin-4-yl]hexan-1-one |
|---|---|
| PubChem CID | 82849703 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-amino-1-[2-(4-chlorophenyl)morpholin-4-yl]hexan-1-one |
| SMILES | CC(N)CCCC(=O)N1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-12(18)3-2-4-16(20)19-9-10-21-15(11-19)13-5-7-14(17)8-6-13/h5-8,12,15H,2-4,9-11,18H2,1H3 |
| InChIKey | LENWHBXLSTZBTQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |