C20H21Cl2N3O2 — CID 134080021
[2-(3,4-dichlorophenyl)morpholin-4-yl]-(4-pyrazolidin-3-ylphenyl)methanone (PubChem CID 134080021) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)morpholin-4-yl]-(4-pyrazolidin-3-ylphenyl)methanone.
| Compound Name | [2-(3,4-dichlorophenyl)morpholin-4-yl]-(4-pyrazolidin-3-ylphenyl)methanone |
|---|---|
| PubChem CID | 134080021 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-(3,4-dichlorophenyl)morpholin-4-yl]-(4-pyrazolidin-3-ylphenyl)methanone |
| SMILES | O=C(c1ccc(C2CCNN2)cc1)N1CCOC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c21-16-6-5-15(11-17(16)22)19-12-25(9-10-27-19)20(26)14-3-1-13(2-4-14)18-7-8-23-24-18/h1-6,11,18-19,23-24H,7-10,12H2 |
| InChIKey | MMCTWZLWVWMGLS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |