C20H16Cl2N2O2 — CID 95188416
[(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-quinolin-7-ylmethanone (PubChem CID 95188416) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is [(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-quinolin-7-ylmethanone.
| Compound Name | [(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-quinolin-7-ylmethanone |
|---|---|
| PubChem CID | 95188416 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [(2S)-2-(3,4-dichlorophenyl)morpholin-4-yl]-quinolin-7-ylmethanone |
| SMILES | O=C(c1ccc2cccnc2c1)N1CCO[C@@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c21-16-6-5-14(10-17(16)22)19-12-24(8-9-26-19)20(25)15-4-3-13-2-1-7-23-18(13)11-15/h1-7,10-11,19H,8-9,12H2/t19-/m1/s1 |
| InChIKey | DVEDESPLKZUHOM-LJQANCHMSA-N |
| XLogP | 4.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |