C20H20N4O2 — CID 110115591
[2-(4,6-dimethylpyrimidin-2-yl)morpholin-4-yl]-quinolin-6-ylmethanone (PubChem CID 110115591) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)morpholin-4-yl]-quinolin-6-ylmethanone.
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)morpholin-4-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 110115591 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)morpholin-4-yl]-quinolin-6-ylmethanone |
| SMILES | Cc1cc(C)nc(C2CN(C(=O)c3ccc4ncccc4c3)CCO2)n1 |
| InChI | InChI=1S/C20H20N4O2/c1-13-10-14(2)23-19(22-13)18-12-24(8-9-26-18)20(25)16-5-6-17-15(11-16)4-3-7-21-17/h3-7,10-11,18H,8-9,12H2,1-2H3 |
| InChIKey | WDANHANYMRPATR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |