C21H20N4O3 — CID 42690648
N-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-1-ylphthalazine-1-carboxamide (PubChem CID 42690648) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-1-ylphthalazine-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-1-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690648 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-pyrrolidin-1-ylphthalazine-1-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1nnc(N2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C21H20N4O3/c26-21(22-12-14-7-8-17-18(11-14)28-13-27-17)19-15-5-1-2-6-16(15)20(24-23-19)25-9-3-4-10-25/h1-2,5-8,11H,3-4,9-10,12-13H2,(H,22,26) |
| InChIKey | NGOJYAHYFHNDLT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |