C21H23N3O4 — CID 108947251
N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide (PubChem CID 108947251) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108947251 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccc(N2CCCC2)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N3O4/c25-20(22-13-15-3-8-18-19(11-15)28-14-27-18)12-21(26)23-16-4-6-17(7-5-16)24-9-1-2-10-24/h3-8,11H,1-2,9-10,12-14H2,(H,22,25)(H,23,26) |
| InChIKey | ZXXSLTKXZMMMFR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|