C24H24N4OS2 — CID 133277456
N-(2-thiophen-2-ylethyl)-1-(2-thiophen-2-ylquinazolin-4-yl)piperidine-4-carboxamide (PubChem CID 133277456) has the molecular formula C24H24N4OS2 and a molecular weight of 448.62 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)-1-(2-thiophen-2-ylquinazolin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-(2-thiophen-2-ylethyl)-1-(2-thiophen-2-ylquinazolin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133277456 |
| Molecular Formula | C24H24N4OS2 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)-1-(2-thiophen-2-ylquinazolin-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CCN(c2nc(-c3cccs3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H24N4OS2/c29-24(25-12-9-18-5-3-15-30-18)17-10-13-28(14-11-17)23-19-6-1-2-7-20(19)26-22(27-23)21-8-4-16-31-21/h1-8,15-17H,9-14H2,(H,25,29) |
| InChIKey | QBHPYPPUULMSIQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |