C17H22N4OS — CID 133304116
1-(6-methylpyrimidin-4-yl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide (PubChem CID 133304116) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-(6-methylpyrimidin-4-yl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-methylpyrimidin-4-yl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133304116 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-(6-methylpyrimidin-4-yl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(N2CCC(C(=O)NCCc3cccs3)CC2)ncn1 |
| InChI | InChI=1S/C17H22N4OS/c1-13-11-16(20-12-19-13)21-8-5-14(6-9-21)17(22)18-7-4-15-3-2-10-23-15/h2-3,10-12,14H,4-9H2,1H3,(H,18,22) |
| InChIKey | JGNSLUVXIRVSTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |