C18H20N6OS — CID 56764920
1-(6-imidazol-1-ylpyrimidin-4-yl)-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 56764920) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-(6-imidazol-1-ylpyrimidin-4-yl)-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-imidazol-1-ylpyrimidin-4-yl)-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56764920 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-(6-imidazol-1-ylpyrimidin-4-yl)-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccs1)C1CCN(c2cc(-n3ccnc3)ncn2)CC1 |
| InChI | InChI=1S/C18H20N6OS/c25-18(20-11-15-2-1-9-26-15)14-3-6-23(7-4-14)16-10-17(22-12-21-16)24-8-5-19-13-24/h1-2,5,8-10,12-14H,3-4,6-7,11H2,(H,20,25) |
| InChIKey | GSDVAORLDVKRKM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |