C17H19F3N4OS — CID 91892471
N-(2-thiophen-2-ylethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 91892471) has the molecular formula C17H19F3N4OS and a molecular weight of 384.43 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-thiophen-2-ylethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91892471 |
| Molecular Formula | C17H19F3N4OS |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CCN(c2cc(C(F)(F)F)ncn2)CC1 |
| InChI | InChI=1S/C17H19F3N4OS/c18-17(19,20)14-10-15(23-11-22-14)24-7-4-12(5-8-24)16(25)21-6-3-13-2-1-9-26-13/h1-2,9-12H,3-8H2,(H,21,25) |
| InChIKey | NTLBJNIPMWJFKB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |