C16H21F3N4O2 — CID 91892475
N-(oxolan-2-ylmethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 91892475) has the molecular formula C16H21F3N4O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91892475 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCN(c2cc(C(F)(F)F)ncn2)CC1 |
| InChI | InChI=1S/C16H21F3N4O2/c17-16(18,19)13-8-14(22-10-21-13)23-5-3-11(4-6-23)15(24)20-9-12-2-1-7-25-12/h8,10-12H,1-7,9H2,(H,20,24) |
| InChIKey | FPSJXNRCNRELPE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |