C18H19F3N4O — CID 91892456
N-benzyl-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 91892456) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is N-benzyl-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91892456 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-benzyl-1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(c2cc(C(F)(F)F)ncn2)CC1 |
| InChI | InChI=1S/C18H19F3N4O/c19-18(20,21)15-10-16(24-12-23-15)25-8-6-14(7-9-25)17(26)22-11-13-4-2-1-3-5-13/h1-5,10,12,14H,6-9,11H2,(H,22,26) |
| InChIKey | MTMRMFAHMINEOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |