C19H19ClF3N3O — CID 9041027
N-benzyl-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 9041027) has the molecular formula C19H19ClF3N3O and a molecular weight of 397.83 g/mol. Its IUPAC name is N-benzyl-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9041027 |
| Molecular Formula | C19H19ClF3N3O |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-benzyl-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H19ClF3N3O/c20-16-10-15(19(21,22)23)12-24-17(16)26-8-6-14(7-9-26)18(27)25-11-13-4-2-1-3-5-13/h1-5,10,12,14H,6-9,11H2,(H,25,27) |
| InChIKey | GQQPHVBRQBXJIN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |