C21H22ClF3N4O3 — CID 60571839
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-hydroxybenzoyl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 60571839) has the molecular formula C21H22ClF3N4O3 and a molecular weight of 470.88 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-hydroxybenzoyl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-hydroxybenzoyl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60571839 |
| Molecular Formula | C21H22ClF3N4O3 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-hydroxybenzoyl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1)c1ccccc1O |
| InChI | InChI=1S/C21H22ClF3N4O3/c22-16-11-14(21(23,24)25)12-28-18(16)29-9-5-13(6-10-29)19(31)26-7-8-27-20(32)15-3-1-2-4-17(15)30/h1-4,11-13,30H,5-10H2,(H,26,31)(H,27,32) |
| InChIKey | PJZPXNBVBUBTKS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|