C21H21ClF4N4O2 — CID 55974429
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 55974429) has the molecular formula C21H21ClF4N4O2 and a molecular weight of 472.87 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55974429 |
| Molecular Formula | C21H21ClF4N4O2 |
| Molecular Weight | 472.87 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-[(2-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1)c1ccccc1F |
| InChI | InChI=1S/C21H21ClF4N4O2/c22-16-11-14(21(24,25)26)12-29-18(16)30-9-5-13(6-10-30)19(31)27-7-8-28-20(32)15-3-1-2-4-17(15)23/h1-4,11-13H,5-10H2,(H,27,31)(H,28,32) |
| InChIKey | TZPOIWSWOKVLHJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|