C21H30ClF3N4O2 — CID 17479017
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]piperidine-4-carboxamide (PubChem CID 17479017) has the molecular formula C21H30ClF3N4O2 and a molecular weight of 462.94 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17479017 |
| Molecular Formula | C21H30ClF3N4O2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]piperidine-4-carboxamide |
| SMILES | CC1CN(CCCNC(=O)C2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)CC(C)O1 |
| InChI | InChI=1S/C21H30ClF3N4O2/c1-14-12-28(13-15(2)31-14)7-3-6-26-20(30)16-4-8-29(9-5-16)19-18(22)10-17(11-27-19)21(23,24)25/h10-11,14-16H,3-9,12-13H2,1-2H3,(H,26,30) |
| InChIKey | XDKHONBHZVDYDK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|