C21H32F3N5O2 — CID 55747812
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea (PubChem CID 55747812) has the molecular formula C21H32F3N5O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 55747812 |
| Molecular Formula | C21H32F3N5O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea |
| SMILES | CC1CN(CCCNC(=O)NC2CCN(c3ccc(C(F)(F)F)cn3)CC2)CC(C)O1 |
| InChI | InChI=1S/C21H32F3N5O2/c1-15-13-28(14-16(2)31-15)9-3-8-25-20(30)27-18-6-10-29(11-7-18)19-5-4-17(12-26-19)21(22,23)24/h4-5,12,15-16,18H,3,6-11,13-14H2,1-2H3,(H2,25,27,30) |
| InChIKey | WZFCTWAQQCHCFW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|