C17H23ClF3N3O — CID 24680931
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pentan-3-ylpiperidine-4-carboxamide (PubChem CID 24680931) has the molecular formula C17H23ClF3N3O and a molecular weight of 377.84 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pentan-3-ylpiperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pentan-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24680931 |
| Molecular Formula | C17H23ClF3N3O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pentan-3-ylpiperidine-4-carboxamide |
| SMILES | CCC(CC)NC(=O)C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H23ClF3N3O/c1-3-13(4-2)23-16(25)11-5-7-24(8-6-11)15-14(18)9-12(10-22-15)17(19,20)21/h9-11,13H,3-8H2,1-2H3,(H,23,25) |
| InChIKey | UQTLFZPNIZUNQQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |