C22H23N5O — CID 90519014
1-(6-phenylpyrimidin-4-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide (PubChem CID 90519014) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(6-phenylpyrimidin-4-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-phenylpyrimidin-4-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90519014 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-(6-phenylpyrimidin-4-yl)-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccncc1)C1CCN(c2cc(-c3ccccc3)ncn2)CC1 |
| InChI | InChI=1S/C22H23N5O/c28-22(24-15-17-6-10-23-11-7-17)19-8-12-27(13-9-19)21-14-20(25-16-26-21)18-4-2-1-3-5-18/h1-7,10-11,14,16,19H,8-9,12-13,15H2,(H,24,28) |
| InChIKey | NKARGIBCJUAJAP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |