C21H26N4O2 — CID 90519154
N-(oxolan-2-ylmethyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 90519154) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90519154 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCCN(c2cc(-c3ccccc3)ncn2)C1 |
| InChI | InChI=1S/C21H26N4O2/c26-21(22-13-18-9-5-11-27-18)17-8-4-10-25(14-17)20-12-19(23-15-24-20)16-6-2-1-3-7-16/h1-3,6-7,12,15,17-18H,4-5,8-11,13-14H2,(H,22,26) |
| InChIKey | JKICEHWTZYHHMH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |