C22H21BrN4O — CID 90519264
N-(4-bromophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 90519264) has the molecular formula C22H21BrN4O and a molecular weight of 437.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90519264 |
| Molecular Formula | C22H21BrN4O |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-(4-bromophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1CCCN(c2cc(-c3ccccc3)ncn2)C1 |
| InChI | InChI=1S/C22H21BrN4O/c23-18-8-10-19(11-9-18)26-22(28)17-7-4-12-27(14-17)21-13-20(24-15-25-21)16-5-2-1-3-6-16/h1-3,5-6,8-11,13,15,17H,4,7,12,14H2,(H,26,28) |
| InChIKey | FHOXWLWSIIZNPY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |