C22H20ClN5O3 — CID 90519386
N-(4-chloro-3-nitrophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 90519386) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90519386 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-1-(6-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)C1CCCN(c2cc(-c3ccccc3)ncn2)C1 |
| InChI | InChI=1S/C22H20ClN5O3/c23-18-9-8-17(11-20(18)28(30)31)26-22(29)16-7-4-10-27(13-16)21-12-19(24-14-25-21)15-5-2-1-3-6-15/h1-3,5-6,8-9,11-12,14,16H,4,7,10,13H2,(H,26,29) |
| InChIKey | GGYGYDHHHPZMHJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|