C19H20F3N3O3S — CID 26795651
1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide (PubChem CID 26795651) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26795651 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H20F3N3O3S/c20-19(21,22)14-3-4-16(17(12-14)25(27)28)24-9-6-13(7-10-24)18(26)23-8-5-15-2-1-11-29-15/h1-4,11-13H,5-10H2,(H,23,26) |
| InChIKey | SDIAJCIUQDIMPT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|