C22H25F3N6O3 — CID 55705510
1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)piperidine-4-carboxamide (PubChem CID 55705510) has the molecular formula C22H25F3N6O3 and a molecular weight of 478.48 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55705510 |
| Molecular Formula | C22H25F3N6O3 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-(1-pyrimidin-2-ylpiperidin-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CCN(c2ncccn2)CC1)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H25F3N6O3/c23-22(24,25)16-2-3-18(19(14-16)31(33)34)29-10-4-15(5-11-29)20(32)28-17-6-12-30(13-7-17)21-26-8-1-9-27-21/h1-3,8-9,14-15,17H,4-7,10-13H2,(H,28,32) |
| InChIKey | JTDAJHPLHCIWCO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|