C20H19F3N4O5 — CID 27693886
N'-(2-hydroxybenzoyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide (PubChem CID 27693886) has the molecular formula C20H19F3N4O5 and a molecular weight of 452.39 g/mol. Its IUPAC name is N'-(2-hydroxybenzoyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide.
| Compound Name | N'-(2-hydroxybenzoyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 27693886 |
| Molecular Formula | C20H19F3N4O5 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N'-(2-hydroxybenzoyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)c1ccccc1O |
| InChI | InChI=1S/C20H19F3N4O5/c21-20(22,23)13-5-6-15(16(11-13)27(31)32)26-9-7-12(8-10-26)18(29)24-25-19(30)14-3-1-2-4-17(14)28/h1-6,11-12,28H,7-10H2,(H,24,29)(H,25,30) |
| InChIKey | SFBIFWBEPSYQQB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|