C21H21F3N4O4 — CID 42932024
N-(2-amino-2-oxo-1-phenylethyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 42932024) has the molecular formula C21H21F3N4O4 and a molecular weight of 450.42 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42932024 |
| Molecular Formula | C21H21F3N4O4 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C(NC(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C21H21F3N4O4/c22-21(23,24)15-6-7-16(17(12-15)28(31)32)27-10-8-14(9-11-27)20(30)26-18(19(25)29)13-4-2-1-3-5-13/h1-7,12,14,18H,8-11H2,(H2,25,29)(H,26,30) |
| InChIKey | BJYALSXLXNGQKL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|