C21H22F3N3O3 — CID 46600224
1-(2-nitrophenyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 46600224) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-nitrophenyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46600224 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-(2-nitrophenyl)-N-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-14(15-6-8-17(9-7-15)21(22,23)24)25-20(28)16-10-12-26(13-11-16)18-4-2-3-5-19(18)27(29)30/h2-9,14,16H,10-13H2,1H3,(H,25,28) |
| InChIKey | HTEJWIBAOJINLY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|