C23H24F3N3O5 — CID 46793284
[2-oxo-2-(1-phenylethylamino)ethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate (PubChem CID 46793284) has the molecular formula C23H24F3N3O5 and a molecular weight of 479.46 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46793284 |
| Molecular Formula | C23H24F3N3O5 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
| SMILES | CC(NC(=O)COC(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C23H24F3N3O5/c1-15(16-5-3-2-4-6-16)27-21(30)14-34-22(31)17-9-11-28(12-10-17)19-8-7-18(23(24,25)26)13-20(19)29(32)33/h2-8,13,15,17H,9-12,14H2,1H3,(H,27,30) |
| InChIKey | ZTFBOWSUVNETFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|